Difference between revisions of "CPD-19014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c...")
(Created page with "Category:metabolite == Metabolite CPD-19014 == * common-name: ** 2-hydroxy-2-methylpropanoate * smiles: ** cc(o)(c)c(=o)[o-] * inchi-key: ** bwlbgmixkstlsx-uhfffaoysa-m *...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11401 ==
+
== Metabolite CPD-19014 ==
 
* common-name:
 
* common-name:
** l-thyroxine acyl β-d-glucuronide
+
** 2-hydroxy-2-methylpropanoate
 
* smiles:
 
* smiles:
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
+
** cc(o)(c)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** hmtfxpjobpioin-dkbymcrtsa-m
+
** bwlbgmixkstlsx-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 951.992
+
** 103.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10608]]
+
* [[RXN-17608]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine acyl β-d-glucuronide}}
+
{{#set: common-name=2-hydroxy-2-methylpropanoate}}
{{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}}
+
{{#set: inchi-key=inchikey=bwlbgmixkstlsx-uhfffaoysa-m}}
{{#set: molecular-weight=951.992}}
+
{{#set: molecular-weight=103.097}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-19014

  • common-name:
    • 2-hydroxy-2-methylpropanoate
  • smiles:
    • cc(o)(c)c(=o)[o-]
  • inchi-key:
    • bwlbgmixkstlsx-uhfffaoysa-m
  • molecular-weight:
    • 103.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality