Difference between revisions of "CPD-19014"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9099 == * common-name: ** dihydrogeranylgeranyl bacteriopheophytin * smiles: ** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(c...")
(Created page with "Category:metabolite == Metabolite CPD-11401 == * common-name: ** l-thyroxine acyl β-d-glucuronide * smiles: ** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9099 ==
+
== Metabolite CPD-11401 ==
 
* common-name:
 
* common-name:
** dihydrogeranylgeranyl bacteriopheophytin
+
** l-thyroxine acyl β-d-glucuronide
 
* smiles:
 
* smiles:
** ccc5(c4(=cc6(=c(c)c1(=c(c([c-](c(=o)oc)c(=o)1)=c2(c(ccc(occ=c(c)cccc(c)ccc=c(c)ccc=c(c)c)=o)c(c)c(=n2)c=c3(c(c)=c(c(c)=o)c(n3)=cc(=n4)c(c)5)))n6))))
+
** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
 
* inchi-key:
 
* inchi-key:
** fzuvlshmhogmop-xqjlcrkzsa-n
+
** hmtfxpjobpioin-dkbymcrtsa-m
 
* molecular-weight:
 
* molecular-weight:
** 884.189
+
** 951.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8795]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8794]]
+
* [[RXN-10608]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihydrogeranylgeranyl bacteriopheophytin}}
+
{{#set: common-name=l-thyroxine acyl β-d-glucuronide}}
{{#set: inchi-key=inchikey=fzuvlshmhogmop-xqjlcrkzsa-n}}
+
{{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}}
{{#set: molecular-weight=884.189}}
+
{{#set: molecular-weight=951.992}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-11401

  • common-name:
    • l-thyroxine acyl β-d-glucuronide
  • smiles:
    • c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
  • inchi-key:
    • hmtfxpjobpioin-dkbymcrtsa-m
  • molecular-weight:
    • 951.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality