Difference between revisions of "CPD-19042"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * common-name: ** l-citrulline * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-19042 == * common-name: ** 2-hydroxyisobutyramide * smiles: ** cc(o)(c)c(=o)n * inchi-key: ** drymmxubdrjpds-uhfffaoysa-n * molecular...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19042 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-hydroxyisobutyramide |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(c)c(=o)n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** drymmxubdrjpds-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 103.121 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17608]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-hydroxyisobutyramide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=drymmxubdrjpds-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.121}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-19042
- common-name:
- 2-hydroxyisobutyramide
- smiles:
- cc(o)(c)c(=o)n
- inchi-key:
- drymmxubdrjpds-uhfffaoysa-n
- molecular-weight:
- 103.121
