Difference between revisions of "CPD-19070"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
(Created page with "Category:metabolite == Metabolite ETF-Reduced == * common-name: ** a reduced electron-transfer flavoprotein == Reaction(s) known to consume the compound == * 1.5.5.1-RXN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPATE ==
+
== Metabolite ETF-Reduced ==
 
* common-name:
 
* common-name:
** sinapate
+
** a reduced electron-transfer flavoprotein
* smiles:
 
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
 
* inchi-key:
 
** pcmortlopmlefb-onegzznksa-m
 
* molecular-weight:
 
** 223.205
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10919]]
+
* [[1.5.5.1-RXN]]
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11734]]
 +
* [[RXN-14229]]
 +
* [[RXN-14262]]
 +
* [[RXN-14278]]
 +
* [[RXN66-550]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3422]]
+
* [[1.5.5.1-RXN]]
* [[RXN-8014]]
+
* [[ACYLCOADEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROG-RXN]]
 +
* [[GLUTARYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11734]]
 +
* [[RXN-13449]]
 +
* [[RXN-13615]]
 +
* [[RXN-14229]]
 +
* [[RXN-14262]]
 +
* [[RXN-14278]]
 +
* [[RXN-17775]]
 +
* [[RXN-17779]]
 +
* [[RXN-17783]]
 +
* [[RXN-17784]]
 +
* [[RXN-17788]]
 +
* [[RXN-17792]]
 +
* [[RXN-17796]]
 +
* [[RXN0-2301]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapate}}
+
{{#set: common-name=a reduced electron-transfer flavoprotein}}
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
 
{{#set: molecular-weight=223.205}}
 

Revision as of 08:24, 15 March 2021