Difference between revisions of "CPD-19071"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22544 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * smiles: ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) * in...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite LIOTHYRONINE == |
| − | = | + | * common-name: |
| − | + | ** 3,5,3'-triiodo-l-thyronine | |
| − | = | + | * smiles: |
| − | + | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) | |
| − | * | + | * inchi-key: |
| − | *** | + | ** auyycjsjgjycds-lbprgkrzsa-n |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 650.978 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10607]] |
| − | + | * [[RXN-10609]] | |
| − | {{#set: | + | * [[RXN-10615]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} | ||
| + | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} | ||
| + | {{#set: molecular-weight=650.978}} | ||
Revision as of 20:32, 18 December 2020
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- molecular-weight:
- 650.978
