Difference between revisions of "CPD-19071"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15662 == * common-name: ** (3r)-hydroxy, 4-trans-undecenoyl-coa * smiles: ** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
(Created page with "Category:metabolite == Metabolite CPD-19071 == * common-name: ** (25s)-26-oxocholesterol * smiles: ** cc([ch]=o)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15662 ==
+
== Metabolite CPD-19071 ==
 
* common-name:
 
* common-name:
** (3r)-hydroxy, 4-trans-undecenoyl-coa
+
** (25s)-26-oxocholesterol
 
* smiles:
 
* smiles:
** ccccccc=cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc([ch]=o)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** anvriwfxmmcuph-qyzxfxbmsa-j
+
** jugxqejpwdyojv-vicxtrefsa-n
 
* molecular-weight:
 
* molecular-weight:
** 945.764
+
** 400.643
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17654]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14791]]
+
* [[RXN-17653]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy, 4-trans-undecenoyl-coa}}
+
{{#set: common-name=(25s)-26-oxocholesterol}}
{{#set: inchi-key=inchikey=anvriwfxmmcuph-qyzxfxbmsa-j}}
+
{{#set: inchi-key=inchikey=jugxqejpwdyojv-vicxtrefsa-n}}
{{#set: molecular-weight=945.764}}
+
{{#set: molecular-weight=400.643}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-19071

  • common-name:
    • (25s)-26-oxocholesterol
  • smiles:
    • cc([ch]=o)cccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • jugxqejpwdyojv-vicxtrefsa-n
  • molecular-weight:
    • 400.643

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality