Difference between revisions of "CPD-19072"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
(Created page with "Category:metabolite == Metabolite CPD-19072 == * common-name: ** (25s)-3β-hydroxycholest-5-en-26-oate * smiles: ** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-GLUCURONATE ==
+
== Metabolite CPD-19072 ==
 
* common-name:
 
* common-name:
** udp-α-d-glucuronate
+
** (25s)-3β-hydroxycholest-5-en-26-oate
 
* smiles:
 
* smiles:
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** wvxomprlwlxfap-ddmwtqrysa-m
 
* molecular-weight:
 
* molecular-weight:
** 577.265
+
** 415.635
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.4.1.212-RXN]]
 
* [[2.4.1.225-RXN]]
 
* [[2.7.7.44-RXN]]
 
* [[RXN-10606]]
 
* [[RXN-10607]]
 
* [[RXN-10608]]
 
* [[RXN-10609]]
 
* [[RXN-10616]]
 
* [[RXN-10617]]
 
* [[RXN-10618]]
 
* [[RXN-10619]]
 
* [[RXN-10784]]
 
* [[RXN-11060]]
 
* [[RXN-13607]]
 
* [[RXN-13608]]
 
* [[RXN-14361]]
 
* [[RXN-9000]]
 
* [[RXN66-162]]
 
* [[RXN66-168]]
 
* [[RXN66-83]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
* [[UGDC]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.44-RXN]]
+
* [[RXN-12701]]
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
* [[RXN-17654]]
* [[UGD-RXN]]
 
* [[UGDH]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-&alpha;-d-glucuronate}}
+
{{#set: common-name=(25s)-3&beta;-hydroxycholest-5-en-26-oate}}
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
+
{{#set: inchi-key=inchikey=wvxomprlwlxfap-ddmwtqrysa-m}}
{{#set: molecular-weight=577.265}}
+
{{#set: molecular-weight=415.635}}

Latest revision as of 11:10, 18 March 2021

Metabolite CPD-19072

  • common-name:
    • (25s)-3β-hydroxycholest-5-en-26-oate
  • smiles:
    • cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • wvxomprlwlxfap-ddmwtqrysa-m
  • molecular-weight:
    • 415.635

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality