Difference between revisions of "CPD-19072"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
(Created page with "Category:metabolite == Metabolite CPD-19072 == * common-name: ** (25s)-3β-hydroxycholest-5-en-26-oate * smiles: ** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19072 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (25s)-3β-hydroxycholest-5-en-26-oate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wvxomprlwlxfap-ddmwtqrysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 415.635 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12701]] |
| + | * [[RXN-17654]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(25s)-3β-hydroxycholest-5-en-26-oate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvxomprlwlxfap-ddmwtqrysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=415.635}} |
Latest revision as of 11:10, 18 March 2021
Contents
Metabolite CPD-19072
- common-name:
- (25s)-3β-hydroxycholest-5-en-26-oate
- smiles:
- cc(cccc(c(=o)[o-])c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- wvxomprlwlxfap-ddmwtqrysa-m
- molecular-weight:
- 415.635
