Difference between revisions of "CPD-19072"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ15217 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...")
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ15217 ==
+
== Metabolite UDP-GLUCURONATE ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[S.japonica_carotenoid_curated]]
+
** udp-α-d-glucuronate
== Reaction(s) associated ==
+
* smiles:
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
+
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
** Category: [[orthology]]
+
* inchi-key:
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
** hdyanyhvcapmjv-lxqifkjmsa-k
== Pathway(s) associated ==
+
* molecular-weight:
* [[PWY-5951]]
+
** 577.265
** '''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to consume the compound ==
* [[PWY3O-246]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[2.4.1.212-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[2.4.1.225-RXN]]
{{#set: nb reaction associated=1}}
+
* [[2.7.7.44-RXN]]
{{#set: nb pathway associated=2}}
+
* [[RXN-10606]]
 +
* [[RXN-10607]]
 +
* [[RXN-10608]]
 +
* [[RXN-10609]]
 +
* [[RXN-10616]]
 +
* [[RXN-10617]]
 +
* [[RXN-10618]]
 +
* [[RXN-10619]]
 +
* [[RXN-10784]]
 +
* [[RXN-11060]]
 +
* [[RXN-13607]]
 +
* [[RXN-13608]]
 +
* [[RXN-14361]]
 +
* [[RXN-9000]]
 +
* [[RXN66-162]]
 +
* [[RXN66-168]]
 +
* [[RXN66-83]]
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 +
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 +
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 +
* [[UGDC]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.7.7.44-RXN]]
 +
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 +
* [[UGD-RXN]]
 +
* [[UGDH]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 +
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 +
{{#set: molecular-weight=577.265}}

Revision as of 20:29, 18 December 2020

Metabolite UDP-GLUCURONATE

  • common-name:
    • udp-α-d-glucuronate
  • smiles:
    • c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
  • inchi-key:
    • hdyanyhvcapmjv-lxqifkjmsa-k
  • molecular-weight:
    • 577.265

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality