Difference between revisions of "CPD-19072"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-GLUCURONATE == * common-name: ** udp-α-d-glucuronate * smiles: ** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-...")
(Created page with "Category:gene == Gene SJ04738 == * transcription-direction: ** negative * right-end-position: ** 54207 * left-end-position: ** 49570 * centisome-position: ** 9.79412 =...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite UDP-GLUCURONATE ==
+
== Gene SJ04738 ==
−
* common-name:
+
* transcription-direction:
−
** udp-α-d-glucuronate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** 54207
−
* inchi-key:
+
* left-end-position:
−
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** 49570
−
* molecular-weight:
+
* centisome-position:
−
** 577.265
+
** 9.79412   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.4.1.212-RXN]]
+
== Reaction(s) associated ==
−
* [[2.4.1.225-RXN]]
+
* [[NADH-DEHYDROGENASE-RXN]]
−
* [[2.7.7.44-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-10606]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-10607]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN-10608]]
+
{{#set: right-end-position=54207}}
−
* [[RXN-10609]]
+
{{#set: left-end-position=49570}}
−
* [[RXN-10616]]
+
{{#set: centisome-position=9.79412    }}
−
* [[RXN-10617]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[RXN-10618]]
+
{{#set: nb reaction associated=1}}
−
* [[RXN-10619]]
 
−
* [[RXN-10784]]
 
−
* [[RXN-11060]]
 
−
* [[RXN-13607]]
 
−
* [[RXN-13608]]
 
−
* [[RXN-14361]]
 
−
* [[RXN-9000]]
 
−
* [[RXN66-162]]
 
−
* [[RXN66-168]]
 
−
* [[RXN66-83]]
 
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
−
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
−
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
−
* [[UGDC]]
 
−
</div>
 
−
== Reaction(s) known to produce the compound ==
 
−
* [[2.7.7.44-RXN]]
 
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
−
* [[UGD-RXN]]
 
−
* [[UGDH]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 
−
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 
−
{{#set: molecular-weight=577.265}}
 

Revision as of 14:53, 5 January 2021

Gene SJ04738

  • transcription-direction:
    • negative
  • right-end-position:
    • 54207
  • left-end-position:
    • 49570
  • centisome-position:
    • 9.79412

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-19072&oldid=58449"