Difference between revisions of "CPD-19147"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cytochrome-c-N-O-methyl-arginines == * common-name: ** [cytochrome c]-nω-methyl-arginine == Reaction(s) known to consume the compou...")
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cytochrome-c-N-O-methyl-arginines ==
+
== Metabolite CPD-19147 ==
 
* common-name:
 
* common-name:
** [cytochrome c]-nω-methyl-arginine
+
** (7z)-tetradecenoyl-coa
 +
* smiles:
 +
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** jpihvkickvpffy-twafkmgksa-j
 +
* molecular-weight:
 +
** 971.845
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17792]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.124-RXN]]
+
* [[RXN-17791]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=[cytochrome c]-nω-methyl-arginine}}
+
{{#set: common-name=(7z)-tetradecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
 +
{{#set: molecular-weight=971.845}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19147

  • common-name:
    • (7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jpihvkickvpffy-twafkmgksa-j
  • molecular-weight:
    • 971.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality