Difference between revisions of "CPD-19147"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BIO-5-AMP == * common-name: ** biotinyl-5'-adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op([o-])(=o)oc(=o)ccccc4(...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * smiles: ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) * inchi-key: ** l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXY-TRYPTOPHAN == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxy-l-tryptophan |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ldcyzajdbxycgn-vifpvbqesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.227 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN3DJ-170]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxy-l-tryptophan}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.227}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite 5-HYDROXY-TRYPTOPHAN
- common-name:
- 5-hydroxy-l-tryptophan
- smiles:
- c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
- inchi-key:
- ldcyzajdbxycgn-vifpvbqesa-n
- molecular-weight:
- 220.227
