Difference between revisions of "CPD-19148"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...")
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THIAMINE ==
+
== Metabolite CPD-19148 ==
 
* common-name:
 
* common-name:
** thiamine
+
** (5z)-dodecenoyl-coa
 
* smiles:
 
* smiles:
** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2))
+
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** jzrwcgzrtzmzeh-uhfffaoysa-n
+
** rcvjzgbrlgutkt-cggpsvllsa-j
 
* molecular-weight:
 
* molecular-weight:
** 265.352
+
** 943.792
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[RXN-17796]]
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 
* [[THIAMINASE-RXN]]
 
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-THIAMINE]]
+
* [[RXN-17795]]
* [[TransportSeed-THIAMINE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=thiamine}}
+
{{#set: common-name=(5z)-dodecenoyl-coa}}
{{#set: inchi-key=inchikey=jzrwcgzrtzmzeh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
{{#set: molecular-weight=265.352}}
+
{{#set: molecular-weight=943.792}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-19148

  • common-name:
    • (5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rcvjzgbrlgutkt-cggpsvllsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality