Difference between revisions of "CPD-19148"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21271 == * transcription-direction: ** positive * right-end-position: ** 16265 * left-end-position: ** 7333 * centisome-position: ** 3.7518163...")
 
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21271 ==
+
== Metabolite CPD-19148 ==
* transcription-direction:
+
* common-name:
** positive
+
** (5z)-dodecenoyl-coa
* right-end-position:
+
* smiles:
** 16265
+
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 7333
+
** rcvjzgbrlgutkt-cggpsvllsa-j
* centisome-position:
+
* molecular-weight:
** 3.7518163   
+
** 943.792
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17796]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.1.6.12-RXN]]
+
* [[RXN-17795]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(5z)-dodecenoyl-coa}}
* [[ARYLSULFAT-RXN]]
+
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
** Category: [[annotation]]
+
{{#set: molecular-weight=943.792}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=16265}}
 
{{#set: left-end-position=7333}}
 
{{#set: centisome-position=3.7518163    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-19148

  • common-name:
    • (5z)-dodecenoyl-coa
  • smiles:
    • ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • rcvjzgbrlgutkt-cggpsvllsa-j
  • molecular-weight:
    • 943.792

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality