Difference between revisions of "CPD-19151"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20749 == * transcription-direction: ** negative * right-end-position: ** 1242 * left-end-position: ** 274 * centisome-position: ** 19.797688 ==...") |
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...") |
||
| (9 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-19151 == |
| − | * | + | * common-name: |
| − | ** | + | ** (s)-3-hydroxy-(5z)-dodecenoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** ayordfmyybnsbo-qccsjadrsa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 959.791 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17798]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-17797]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}} | |
| − | == | + | {{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}} |
| − | + | {{#set: molecular-weight=959.791}} | |
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-19151
- common-name:
- (s)-3-hydroxy-(5z)-dodecenoyl-coa
- smiles:
- ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- ayordfmyybnsbo-qccsjadrsa-j
- molecular-weight:
- 959.791
