Difference between revisions of "CPD-19151"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05137 == * transcription-direction: ** negative * right-end-position: ** 111821 * left-end-position: ** 94708 * centisome-position: ** 18.881594...")
(Created page with "Category:metabolite == Metabolite CPD-17402 == * common-name: ** (3r)-hydroxy-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05137 ==
+
== Metabolite CPD-17402 ==
* transcription-direction:
+
* common-name:
** negative
+
** (3r)-hydroxy-auricoloyl-coa
* right-end-position:
+
* smiles:
** 111821
+
** ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 94708
+
** xtsclycoojhttr-ktfrusdtsa-j
* centisome-position:
+
* molecular-weight:
** 18.881594   
+
** 1085.989
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16155]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[2.4.1.101-RXN]]
+
* [[RXN-16154]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(3r)-hydroxy-auricoloyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=xtsclycoojhttr-ktfrusdtsa-j}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1085.989}}
* [[2.4.1.223-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[2.4.1.94-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7426]]
 
** '''4''' reactions found over '''10''' reactions in the full pathway
 
* [[PWY-7920]]
 
** '''2''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-6558]]
 
** '''7''' reactions found over '''13''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=111821}}
 
{{#set: left-end-position=94708}}
 
{{#set: centisome-position=18.881594    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=3}}
 

Revision as of 20:30, 18 December 2020

Metabolite CPD-17402

  • common-name:
    • (3r)-hydroxy-auricoloyl-coa
  • smiles:
    • ccc=cccc(o)cc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xtsclycoojhttr-ktfrusdtsa-j
  • molecular-weight:
    • 1085.989

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality