Difference between revisions of "CPD-19151"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPYL-ALCOHOL == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=cco)c=c(oc)c(o)=1) * inchi-key: ** lzfopexouvtgjs-onegzznksa...") |
(Created page with "Category:metabolite == Metabolite Xyloglucans-Galactose-23 == * common-name: ** an xllg xylogulcan == Reaction(s) known to consume the compound == * RXN-9463 == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Xyloglucans-Galactose-23 == |
* common-name: | * common-name: | ||
− | ** | + | ** an xllg xylogulcan |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-9463]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an xllg xylogulcan}} |
− | |||
− |
Revision as of 18:52, 14 January 2021
Contents
Metabolite Xyloglucans-Galactose-23
- common-name:
- an xllg xylogulcan