Difference between revisions of "CPD-19153"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-253 == * common-name: ** 4,5-seco-dopa * smiles: ** c(=o)c=c(cc([n+])c(=o)[o-])c=c(c([o-])=o)o * inchi-key: ** fnegjfdtwwxqes-qtwonpp...") |
(Created page with "Category:metabolite == Metabolite VAL == * common-name: ** l-valine * smiles: ** cc(c)c([n+])c([o-])=o * inchi-key: ** kzsnjwfqevhdmf-bypyzucnsa-n * molecular-weight: ** 1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite VAL == |
* common-name: | * common-name: | ||
− | ** | + | ** l-valine |
* smiles: | * smiles: | ||
− | ** c | + | ** cc(c)c([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kzsnjwfqevhdmf-bypyzucnsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 117.147 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] | ||
+ | * [[RXN-16291]] | ||
+ | * [[RXN-16294]] | ||
+ | * [[RXN-16991]] | ||
+ | * [[VALINE--TRNA-LIGASE-RXN]] | ||
+ | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]] |
+ | * [[RXN-16294]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-valine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kzsnjwfqevhdmf-bypyzucnsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=117.147}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite VAL
- common-name:
- l-valine
- smiles:
- cc(c)c([n+])c([o-])=o
- inchi-key:
- kzsnjwfqevhdmf-bypyzucnsa-n
- molecular-weight:
- 117.147
Reaction(s) known to consume the compound
- BRANCHED-CHAINAMINOTRANSFERVAL-RXN
- RXN-16291
- RXN-16294
- RXN-16991
- VALINE--TRNA-LIGASE-RXN
- biomass_rxn