Difference between revisions of "CPD-19155"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...")
(Created page with "Category:metabolite == Metabolite RX == * smiles: ** [r]x * common-name: ** rx == Reaction(s) known to consume the compound == * GSHTRAN-RXN == Reaction(s) known to pr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DI-H-OROTATE ==
+
== Metabolite RX ==
 +
* smiles:
 +
** [r]x
 
* common-name:
 
* common-name:
** (s)-dihydroorotate
+
** rx
* smiles:
 
** c1(c(=o)nc(=o)nc(c(=o)[o-])1)
 
* inchi-key:
 
** ufivepvsagbusi-reohclbhsa-m
 
* molecular-weight:
 
** 157.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROOROT-RXN]]
+
* [[GSHTRAN-RXN]]
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
 
* [[RXN0-6491]]
 
* [[RXN0-6554]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-dihydroorotate}}
+
{{#set: common-name=rx}}
{{#set: inchi-key=inchikey=ufivepvsagbusi-reohclbhsa-m}}
 
{{#set: molecular-weight=157.105}}
 

Revision as of 11:17, 15 January 2021

Metabolite RX

  • smiles:
    • [r]x
  • common-name:
    • rx

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality