Difference between revisions of "CPD-19155"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DI-H-OROTATE == * common-name: ** (s)-dihydroorotate * smiles: ** c1(c(=o)nc(=o)nc(c(=o)[o-])1) * inchi-key: ** ufivepvsagbusi-reohclbhsa...") |
(Created page with "Category:metabolite == Metabolite RX == * smiles: ** [r]x * common-name: ** rx == Reaction(s) known to consume the compound == * GSHTRAN-RXN == Reaction(s) known to pr...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RX == |
+ | * smiles: | ||
+ | ** [r]x | ||
* common-name: | * common-name: | ||
− | ** | + | ** rx |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GSHTRAN-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=rx}} |
− | |||
− |
Revision as of 11:17, 15 January 2021
Contents
Metabolite RX
- smiles:
- [r]x
- common-name:
- rx