Difference between revisions of "CPD-19155"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(...")
(Created page with "Category:metabolite == Metabolite CPD-19155 == * common-name: ** (s)-3-hydroxy-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite CPD-19155 ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** (s)-3-hydroxy-(9z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+
** ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** luewuzlmquobsb-ayqjavfrsa-n
+
** zirsqpaphgzdil-vscxgisksa-j
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[RXN-17790]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[RXN-17789]]
* [[RXN-14281]]
 
* [[RXN-14284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=(s)-3-hydroxy-(9z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
+
{{#set: inchi-key=inchikey=zirsqpaphgzdil-vscxgisksa-j}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=1015.898}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-19155

  • common-name:
    • (s)-3-hydroxy-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zirsqpaphgzdil-vscxgisksa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality