Difference between revisions of "CPD-19155"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-650 == * common-name: ** (3r)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * smiles: ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-650 ==
+
== Metabolite MALTOTETRAOSE ==
 
* common-name:
 
* common-name:
** (3r)-3-hydroxybutanoyl-coa
+
** maltotetraose
 
* smiles:
 
* smiles:
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
 
* inchi-key:
 
* inchi-key:
** qhhkkmyhdbrony-wzzmxtmrsa-j
+
** luewuzlmquobsb-ayqjavfrsa-n
 
* molecular-weight:
 
* molecular-weight:
** 849.593
+
** 666.583
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5182]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5901]]
+
* [[GLYMALTOPHOSPHORYL-RXN]]
 +
* [[RXN-14281]]
 +
* [[RXN-14284]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-3-hydroxybutanoyl-coa}}
+
{{#set: common-name=maltotetraose}}
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-wzzmxtmrsa-j}}
+
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
{{#set: molecular-weight=849.593}}
+
{{#set: molecular-weight=666.583}}

Revision as of 13:11, 14 January 2021

Metabolite MALTOTETRAOSE

  • common-name:
    • maltotetraose
  • smiles:
    • c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
  • inchi-key:
    • luewuzlmquobsb-ayqjavfrsa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality