Difference between revisions of "CPD-19157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16671 == * transcription-direction: ** positive * right-end-position: ** 218879 * left-end-position: ** 210868 * centisome-position: ** 75.81389...")
(Created page with "Category:metabolite == Metabolite CPD-7002 == * common-name: ** dihydrogeranylgeranyl diphosphate * smiles: ** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16671 ==
+
== Metabolite CPD-7002 ==
* transcription-direction:
+
* common-name:
** positive
+
** dihydrogeranylgeranyl diphosphate
* right-end-position:
+
* smiles:
** 218879
+
** cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
* left-end-position:
+
* inchi-key:
** 210868
+
** yjganofpasczbk-wcnzlwbosa-k
* centisome-position:
+
* molecular-weight:
** 75.81389   
+
** 449.44
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-7658]]
== Reaction(s) associated ==
+
* [[RXN-7659]]
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-7658]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-7659]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=dihydrogeranylgeranyl diphosphate}}
* [[CYSTEINE-DIOXYGENASE-RXN]]
+
{{#set: inchi-key=inchikey=yjganofpasczbk-wcnzlwbosa-k}}
** Category: [[annotation]]
+
{{#set: molecular-weight=449.44}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-7850]]
 
** '''1''' reactions found over '''4''' reactions in the full pathway
 
* [[CYSTEINE-DEG-PWY]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5331]]
 
** '''1''' reactions found over '''5''' reactions in the full pathway
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=218879}}
 
{{#set: left-end-position=210868}}
 
{{#set: centisome-position=75.81389    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=3}}
 

Revision as of 20:32, 18 December 2020

Metabolite CPD-7002

  • common-name:
    • dihydrogeranylgeranyl diphosphate
  • smiles:
    • cc(=cccc(=cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
  • inchi-key:
    • yjganofpasczbk-wcnzlwbosa-k
  • molecular-weight:
    • 449.44

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality