Difference between revisions of "CPD-19158"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...")
(Created page with "Category:metabolite == Metabolite MN+2 == * common-name: ** mn2+ * smiles: ** [mn++] * inchi-key: ** waemqwokjmhjla-uhfffaoysa-n * molecular-weight: ** 54.938 == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7063 ==
+
== Metabolite MN+2 ==
 
* common-name:
 
* common-name:
** red chlorophyll catabolite
+
** mn2+
 
* smiles:
 
* smiles:
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+
** [mn++]
 
* inchi-key:
 
* inchi-key:
** gvtpycxgtfqzdt-yssugppcsa-m
+
** waemqwokjmhjla-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 624.692
+
** 54.938
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7741]]
+
* [[3.6.3.35-RXN]]
 +
* [[ExchangeSeed-MN+2]]
 +
* [[TransportSeed-MN+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7740]]
+
* [[3.6.3.35-RXN]]
 +
* [[ExchangeSeed-MN+2]]
 +
* [[TransportSeed-MN+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=red chlorophyll catabolite}}
+
{{#set: common-name=mn2+}}
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
+
{{#set: inchi-key=inchikey=waemqwokjmhjla-uhfffaoysa-n}}
{{#set: molecular-weight=624.692}}
+
{{#set: molecular-weight=54.938}}

Revision as of 08:28, 15 March 2021

Metabolite MN+2

  • common-name:
    • mn2+
  • smiles:
    • [mn++]
  • inchi-key:
    • waemqwokjmhjla-uhfffaoysa-n
  • molecular-weight:
    • 54.938

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality