Difference between revisions of "CPD-19158"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MN+2 == * common-name: ** mn2+ * smiles: ** [mn++] * inchi-key: ** waemqwokjmhjla-uhfffaoysa-n * molecular-weight: ** 54.938 == Reaction(...")
(Created page with "Category:metabolite == Metabolite CPD-19158 == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MN+2 ==
+
== Metabolite CPD-19158 ==
 
* common-name:
 
* common-name:
** mn2+
+
** 3-oxo-(9z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** [mn++]
+
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** waemqwokjmhjla-uhfffaoysa-n
+
** jdnargywmlyada-mdmkaecgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 54.938
+
** 1013.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.3.35-RXN]]
+
* [[RXN-17791]]
* [[ExchangeSeed-MN+2]]
 
* [[TransportSeed-MN+2]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.3.35-RXN]]
+
* [[RXN-17790]]
* [[ExchangeSeed-MN+2]]
 
* [[TransportSeed-MN+2]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mn2+}}
+
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=waemqwokjmhjla-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
{{#set: molecular-weight=54.938}}
+
{{#set: molecular-weight=1013.883}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19158

  • common-name:
    • 3-oxo-(9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jdnargywmlyada-mdmkaecgsa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality