Difference between revisions of "CPD-19159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15365 == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite SORBITOL == * common-name: ** d-sorbitol * smiles: ** c(c(c(c(c(co)o)o)o)o)o * inchi-key: ** fbpfztcfmrresa-jgwlitmvsa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15365 ==
+
== Metabolite SORBITOL ==
 
* common-name:
 
* common-name:
** densipoloyl-coa
+
** d-sorbitol
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c(c(c(c(co)o)o)o)o)o
 
* inchi-key:
 
* inchi-key:
** qebzgoipmjeisg-apevuuacsa-j
+
** fbpfztcfmrresa-jgwlitmvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1041.936
+
** 182.173
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16150]]
+
* [[RXN-7644]]
* [[RXN-16153]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16150]]
+
* [[RXN-7644]]
 +
* [[SBTD_D2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common-name=d-sorbitol}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
+
{{#set: inchi-key=inchikey=fbpfztcfmrresa-jgwlitmvsa-n}}
{{#set: molecular-weight=1041.936}}
+
{{#set: molecular-weight=182.173}}

Revision as of 08:29, 15 March 2021

Metabolite SORBITOL

  • common-name:
    • d-sorbitol
  • smiles:
    • c(c(c(c(c(co)o)o)o)o)o
  • inchi-key:
    • fbpfztcfmrresa-jgwlitmvsa-n
  • molecular-weight:
    • 182.173

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality