Difference between revisions of "CPD-19159"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-Palmitoyl-L-Phosphatidate == * common-name: ** a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite CPD-19159 == * common-name: ** (s)-3-hydroxy-(11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)co...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19159 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-3-hydroxy-(11z)-octadecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** scdxbwnpjageek-kboaxvdlsa-j | ||
| + | * molecular-weight: | ||
| + | ** 1043.952 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17786]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17785]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-3-hydroxy-(11z)-octadecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=scdxbwnpjageek-kboaxvdlsa-j}} | ||
| + | {{#set: molecular-weight=1043.952}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-19159
- common-name:
- (s)-3-hydroxy-(11z)-octadecenoyl-coa
- smiles:
- ccccccc=ccccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- scdxbwnpjageek-kboaxvdlsa-j
- molecular-weight:
- 1043.952
