Difference between revisions of "CPD-19159"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-564 == * common-name: ** s-ribosyl-l-homocysteine * smiles: ** c(cc([n+])c(=o)[o-])scc1(oc(o)c(o)c(o)1) * inchi-key: ** iqfwynfdwrysr...") |
(Created page with "Category:metabolite == Metabolite 2-Palmitoyl-L-Phosphatidate == * common-name: ** a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate == Reaction(s) known to consume the compoun...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-Palmitoyl-L-Phosphatidate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16032]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate}} |
| − | |||
| − | |||
Revision as of 18:57, 14 January 2021
Contents
Metabolite 2-Palmitoyl-L-Phosphatidate
- common-name:
- a 1-acyl-2-palmitoyl-sn-glycerol 3-phosphate
