Difference between revisions of "CPD-19161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...")
(Created page with "Category:metabolite == Metabolite CPD-19161 == * common-name: ** (2e,7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14875 ==
+
== Metabolite CPD-19161 ==
 
* common-name:
 
* common-name:
** grixazone b
+
** (2e,7z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3)))
+
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** kupqduioulxtjz-jtqlqieisa-l
+
** mwksuvqqmpjtpp-dtpvmwfysa-j
 
* molecular-weight:
 
* molecular-weight:
** 415.377
+
** 969.83
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17793]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15414]]
+
* [[RXN-17792]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=grixazone b}}
+
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=kupqduioulxtjz-jtqlqieisa-l}}
+
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
{{#set: molecular-weight=415.377}}
+
{{#set: molecular-weight=969.83}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-19161

  • common-name:
    • (2e,7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • mwksuvqqmpjtpp-dtpvmwfysa-j
  • molecular-weight:
    • 969.83

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality