Difference between revisions of "CPD-19161"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14875 == * common-name: ** grixazone b * smiles: ** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3))) * inchi...")
(Created page with "Category:metabolite == Metabolite CPD-2189 == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14875 ==
+
== Metabolite CPD-2189 ==
 
* common-name:
 
* common-name:
** grixazone b
+
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c(c([o-])=o)c=3)))
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** kupqduioulxtjz-jtqlqieisa-l
+
** djvqakqvqxihel-uilgywmgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 415.377
+
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-8299]]
 +
* [[RXN-8306]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15414]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=grixazone b}}
+
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=kupqduioulxtjz-jtqlqieisa-l}}
+
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
{{#set: molecular-weight=415.377}}
+
{{#set: molecular-weight=751.052}}

Revision as of 11:19, 15 January 2021

Metabolite CPD-2189

  • common-name:
    • 1-18:2-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • djvqakqvqxihel-uilgywmgsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality