Difference between revisions of "CPD-19162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04205 == * transcription-direction: ** negative * right-end-position: ** 42164 * left-end-position: ** 32891 * centisome-position: ** 29.948553...")
(Created page with "Category:metabolite == Metabolite CPD-19162 == * common-name: ** (2e,9z)-hexadecenoyl-coa * smiles: ** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04205 ==
+
== Metabolite CPD-19162 ==
* transcription-direction:
+
* common-name:
** negative
+
** (2e,9z)-hexadecenoyl-coa
* right-end-position:
+
* smiles:
** 42164
+
** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 32891
+
** beqwcbbskhmrca-henmzmgosa-j
* centisome-position:
+
* molecular-weight:
** 29.948553   
+
** 997.883
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-17789]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[RXN-11634]]
+
* [[RXN-17788]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(2e,9z)-hexadecenoyl-coa}}
* [[RXN-14177]]
+
{{#set: inchi-key=inchikey=beqwcbbskhmrca-henmzmgosa-j}}
** Category: [[orthology]]
+
{{#set: molecular-weight=997.883}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=42164}}
 
{{#set: left-end-position=32891}}
 
{{#set: centisome-position=29.948553    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-19162

  • common-name:
    • (2e,9z)-hexadecenoyl-coa
  • smiles:
    • ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • beqwcbbskhmrca-henmzmgosa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality