Difference between revisions of "CPD-19163"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TCP26 TCP26] == * direction: ** reversible == Reaction formula == * 1.0 PPI[C_c] '''<=>''' 1.0...") |
(Created page with "Category:metabolite == Metabolite CPD-19163 == * common-name: ** (2e,11z)-octadecenoyl-coa * smiles: ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-19163 == |
− | * | + | * common-name: |
− | ** | + | ** (2e,11z)-octadecenoyl-coa |
− | == | + | * smiles: |
− | + | ** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
− | = | + | * inchi-key: |
− | + | ** opmpwwfmnywbgf-pkybcsrxsa-j | |
− | * | + | * molecular-weight: |
− | *** | + | ** 1025.937 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[RXN-17785]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-17784]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=(2e,11z)-octadecenoyl-coa}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}} |
− | {{#set: | + | {{#set: molecular-weight=1025.937}} |
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-19163
- common-name:
- (2e,11z)-octadecenoyl-coa
- smiles:
- ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- opmpwwfmnywbgf-pkybcsrxsa-j
- molecular-weight:
- 1025.937