Difference between revisions of "CPD-19168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTUP DUTUP] == * direction: ** left-to-right * common-name: ** dutp:uridine 5'-phosphotransferase...")
(Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTUP DUTUP] ==
+
== Metabolite CPD-19168 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** dutp:uridine 5'-phosphotransferase
+
** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
== Reaction formula ==
+
* smiles:
* 1.0 [[DUTP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[DUDP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c]
+
** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ02034]]
+
** kzlhpkriedlqgg-squpixldsa-j
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 1015.898
* Gene: [[SJ15690]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[RXN-17781]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-17780]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
== External links  ==
+
{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
{{#set: direction=left-to-right}}
+
{{#set: molecular-weight=1015.898}}
{{#set: common-name=dutp:uridine 5'-phosphotransferase}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-19168

  • common-name:
    • (s)-3-hydroxy-(7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kzlhpkriedlqgg-squpixldsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality