Difference between revisions of "CPD-19168"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XYLITOL == * common-name: ** xylitol * smiles: ** c(o)c(o)c(o)c(o)co * inchi-key: ** hebkchpvoiaqta-scdxwvjysa-n * molecular-weight: ** 1...")
(Created page with "Category:metabolite == Metabolite CPD-19168 == * common-name: ** (s)-3-hydroxy-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XYLITOL ==
+
== Metabolite CPD-19168 ==
 
* common-name:
 
* common-name:
** xylitol
+
** (s)-3-hydroxy-(7z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)c(o)c(o)co
+
** ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hebkchpvoiaqta-scdxwvjysa-n
+
** kzlhpkriedlqgg-squpixldsa-j
 
* molecular-weight:
 
* molecular-weight:
** 152.147
+
** 1015.898
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.3.41-RXN]]
+
* [[RXN-17781]]
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
* [[RXN-8773]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
* [[RXN-17780]]
* [[RXN-8773]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xylitol}}
+
{{#set: common-name=(s)-3-hydroxy-(7z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=hebkchpvoiaqta-scdxwvjysa-n}}
+
{{#set: inchi-key=inchikey=kzlhpkriedlqgg-squpixldsa-j}}
{{#set: molecular-weight=152.147}}
+
{{#set: molecular-weight=1015.898}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-19168

  • common-name:
    • (s)-3-hydroxy-(7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kzlhpkriedlqgg-squpixldsa-j
  • molecular-weight:
    • 1015.898

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality