Difference between revisions of "CPD-19169"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-RRNA-N2-METHYLGUANINE2445 == * common-name: ** an n2-methylguanine2445 in 23s rrna == Reaction(s) known to consume the compound == ==...") |
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19169 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-oxo-(9z)-octadecenoyl-coa |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** aveyykdekgjvbu-bpmmelmssa-j | ||
| + | * molecular-weight: | ||
| + | ** 1041.936 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17778]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17777]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}} |
| + | {{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}} | ||
| + | {{#set: molecular-weight=1041.936}} | ||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-19169
- common-name:
- 3-oxo-(9z)-octadecenoyl-coa
- smiles:
- ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- aveyykdekgjvbu-bpmmelmssa-j
- molecular-weight:
- 1041.936
