Difference between revisions of "CPD-19169"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NITRITE == * common-name: ** nitrite * smiles: ** n([o-])=o * inchi-key: ** iovcwxunbopuch-uhfffaoysa-m * molecular-weight: ** 46.005 ==...")
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NITRITE ==
+
== Metabolite CPD-19169 ==
 
* common-name:
 
* common-name:
** nitrite
+
** 3-oxo-(9z)-octadecenoyl-coa
 
* smiles:
 
* smiles:
** n([o-])=o
+
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** iovcwxunbopuch-uhfffaoysa-m
+
** aveyykdekgjvbu-bpmmelmssa-j
 
* molecular-weight:
 
* molecular-weight:
** 46.005
+
** 1041.936
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
+
* [[RXN-17778]]
* [[NITRATREDUCT-RXN]]
 
* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
 
* [[RXN-15838]]
 
* [[RXN0-6377]]
 
* [[TRANS-RXN-137]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
+
* [[RXN-17777]]
* [[NITRATE-REDUCTASE-NADH-RXN]]
 
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 
* [[NITRATE-REDUCTASE-NADPORNOPH-RXN]]
 
* [[NITRATREDUCT-RXN]]
 
* [[RXN-15838]]
 
* [[RXN-16322]]
 
* [[RXN-3661]]
 
* [[TRANS-RXN-137]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nitrite}}
+
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
{{#set: inchi-key=inchikey=iovcwxunbopuch-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
{{#set: molecular-weight=46.005}}
+
{{#set: molecular-weight=1041.936}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-19169

  • common-name:
    • 3-oxo-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • aveyykdekgjvbu-bpmmelmssa-j
  • molecular-weight:
    • 1041.936

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality