Difference between revisions of "CPD-19170"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15367 == * common-name: ** auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c...")
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15367 ==
+
== Metabolite CPD-19170 ==
 
* common-name:
 
* common-name:
** auricoloyl-coa
+
** (2e,7z)-hexadecenoyl-coa
 
* smiles:
 
* smiles:
** ccc=cccc(o)cc=ccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** yxbobeundfmucp-ubnaobjysa-j
+
** yqarrkbgbkpbcx-dvzfgldusa-j
 
* molecular-weight:
 
* molecular-weight:
** 1069.99
+
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16157]]
+
* [[RXN-17780]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16157]]
+
* [[RXN-17779]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=auricoloyl-coa}}
+
{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
{{#set: inchi-key=inchikey=yxbobeundfmucp-ubnaobjysa-j}}
+
{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
{{#set: molecular-weight=1069.99}}
+
{{#set: molecular-weight=997.883}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-19170

  • common-name:
    • (2e,7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • yqarrkbgbkpbcx-dvzfgldusa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality