Difference between revisions of "CPD-19170"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08289 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PNKIN-RXN ** Category:...") |
(Created page with "Category:metabolite == Metabolite CPD-19170 == * common-name: ** (2e,7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-19170 == |
| − | + | * common-name: | |
| − | * | + | ** (2e,7z)-hexadecenoyl-coa |
| − | == | + | * smiles: |
| − | + | ** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | |
| − | + | * inchi-key: | |
| − | + | ** yqarrkbgbkpbcx-dvzfgldusa-j | |
| − | * | + | * molecular-weight: |
| − | + | ** 997.883 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-17780]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | * [[RXN-17779]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=(2e,7z)-hexadecenoyl-coa}} |
| − | + | {{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}} | |
| − | * [[ | + | {{#set: molecular-weight=997.883}} |
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-19170
- common-name:
- (2e,7z)-hexadecenoyl-coa
- smiles:
- ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- yqarrkbgbkpbcx-dvzfgldusa-j
- molecular-weight:
- 997.883
