Difference between revisions of "CPD-19171"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RAD21-Cohesin-Subunits == * common-name: ** a rad21 cohesin subunit == Reaction(s) known to consume the compound == * RXN-11693 == Re...")
(Created page with "Category:metabolite == Metabolite CPD-19171 == * common-name: ** (s)-3-hydroxy-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RAD21-Cohesin-Subunits ==
+
== Metabolite CPD-19171 ==
 
* common-name:
 
* common-name:
** a rad21 cohesin subunit
+
** (s)-3-hydroxy-(9z)-octadecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** lhayytcfpmuqnr-dfxypyghsa-j
 +
* molecular-weight:
 +
** 1043.952
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11693]]
+
* [[RXN-17777]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17776]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a rad21 cohesin subunit}}
+
{{#set: common-name=(s)-3-hydroxy-(9z)-octadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=lhayytcfpmuqnr-dfxypyghsa-j}}
 +
{{#set: molecular-weight=1043.952}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-19171

  • common-name:
    • (s)-3-hydroxy-(9z)-octadecenoyl-coa
  • smiles:
    • ccccccccc=ccccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • lhayytcfpmuqnr-dfxypyghsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality