Difference between revisions of "CPD-19171"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18082 == * transcription-direction: ** positive * right-end-position: ** 141187 * left-end-position: ** 134350 * centisome-position: ** 53.13637...")
(Created page with "Category:metabolite == Metabolite CPD-6992 == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3) * inchi-key: ** suyjzkrqhbq...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18082 ==
+
== Metabolite CPD-6992 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (+)-pinobanksin
−
* right-end-position:
+
* smiles:
−
** 141187
+
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
−
* left-end-position:
+
* inchi-key:
−
** 134350
+
** suyjzkrqhbqnca-lsdhhaiusa-m
−
* centisome-position:
+
* molecular-weight:
−
** 53.13637   
+
** 271.249
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-7648]]
−
* [[CDPDIGLYSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(+)-pinobanksin}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=271.249}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN0-5515]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5981]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY0-1319]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5667]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-7817]]
 
−
** '''6''' reactions found over '''16''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=141187}}
 
−
{{#set: left-end-position=134350}}
 
−
{{#set: centisome-position=53.13637    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=4}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-6992

  • common-name:
    • (+)-pinobanksin
  • smiles:
    • c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
  • inchi-key:
    • suyjzkrqhbqnca-lsdhhaiusa-m
  • molecular-weight:
    • 271.249

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-19171&oldid=46063"