Difference between revisions of "CPD-19179"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4207 == * common-name: ** isopentenyl adenosine * smiles: ** cc(c)=ccnc3(=nc=nc2(n(c1(c(c(c(o1)co)o)o))c=nc=23)) * inchi-key: ** usvm...") |
(Created page with "Category:metabolite == Metabolite CPD-19179 == * common-name: ** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-19179 == |
* common-name: | * common-name: | ||
− | ** | + | ** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4)))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hrbcpxbjawppic-gzbygqqwsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 519.151 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17809]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-8340]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hrbcpxbjawppic-gzbygqqwsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=519.151}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-19179
- common-name:
- (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
- smiles:
- c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
- inchi-key:
- hrbcpxbjawppic-gzbygqqwsa-j
- molecular-weight:
- 519.151