Difference between revisions of "CPD-19179"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...")
(Created page with "Category:metabolite == Metabolite CPD-19179 == * common-name: ** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14202 ==
+
== Metabolite CPD-19179 ==
 
* common-name:
 
* common-name:
** l-erythro-7,8-dihydrobiopterin
+
** (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
 
* smiles:
 
* smiles:
** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n))
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
 
* inchi-key:
 
* inchi-key:
** femxzdutfrtwpe-dzswipipsa-n
+
** hrbcpxbjawppic-gzbygqqwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 239.233
+
** 519.151
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SEPIAPTERIN-REDUCTASE-RXN]]
+
* [[RXN-17809]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7908]]
+
* [[RXN-8340]]
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-erythro-7,8-dihydrobiopterin}}
+
{{#set: common-name=(8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
{{#set: inchi-key=inchikey=femxzdutfrtwpe-dzswipipsa-n}}
+
{{#set: inchi-key=inchikey=hrbcpxbjawppic-gzbygqqwsa-j}}
{{#set: molecular-weight=239.233}}
+
{{#set: molecular-weight=519.151}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-19179

  • common-name:
    • (8s)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c3(oc2(n1(c4(n=c(n)nc(=o)c(n[ch]1c(o)(c(o)2)3)=4))))
  • inchi-key:
    • hrbcpxbjawppic-gzbygqqwsa-j
  • molecular-weight:
    • 519.151

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality