Difference between revisions of "CPD-19179"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16016 RXN-16016] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == * common-name: ** 3-demethylubiquinol-6 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX == |
− | * | + | * common-name: |
− | ** | + | ** 3-demethylubiquinol-6 |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | + | ** zqxnznkhqxlvcv-hgjbzhbgsa-n | |
− | + | * molecular-weight: | |
− | + | ** 578.874 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN3O-102]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=3-demethylubiquinol-6}} |
− | + | {{#set: inchi-key=inchikey=zqxnznkhqxlvcv-hgjbzhbgsa-n}} | |
− | + | {{#set: molecular-weight=578.874}} | |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Revision as of 20:36, 18 December 2020
Contents
Metabolite 2-HEXAPRENYL-3-METHYL-5-HYDROXY-6-METHOX
- common-name:
- 3-demethylubiquinol-6
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=c(c(o)=c1c)o)o))c)c)c)c)c)c
- inchi-key:
- zqxnznkhqxlvcv-hgjbzhbgsa-n
- molecular-weight:
- 578.874