Difference between revisions of "CPD-19179"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14202 == * common-name: ** l-erythro-7,8-dihydrobiopterin * smiles: ** cc(o)c(o)c2(cnc1(nc(=nc(c=1n=2)=o)n)) * inchi-key: ** femxzdut...") |
(Created page with "Category:metabolite == Metabolite Menaquinones == * common-name: ** a menaquinone == Reaction(s) known to consume the compound == * RXN-15740 * RXN0-6554 == Reacti...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Menaquinones == |
* common-name: | * common-name: | ||
| − | ** | + | ** a menaquinone |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15740]] |
| + | * [[RXN0-6554]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14107]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a menaquinone}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite Menaquinones
- common-name:
- a menaquinone
