Difference between revisions of "CPD-19217"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Sulfur-Carrier-Proteins-ThiI == * common-name: ** a [thii sulfur-carrier protein]-l-cysteine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-19217 == * common-name: ** s-(hydroxysulfenamide)-glutathione * smiles: ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19217 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(hydroxysulfenamide)-glutathione |
| + | * smiles: | ||
| + | ** c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** zoiidzwlsvvtgq-wdskdsinsa-m | ||
| + | * molecular-weight: | ||
| + | ** 337.327 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17884]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(hydroxysulfenamide)-glutathione}} |
| + | {{#set: inchi-key=inchikey=zoiidzwlsvvtgq-wdskdsinsa-m}} | ||
| + | {{#set: molecular-weight=337.327}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-19217
- common-name:
- s-(hydroxysulfenamide)-glutathione
- smiles:
- c(sno)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
- inchi-key:
- zoiidzwlsvvtgq-wdskdsinsa-m
- molecular-weight:
- 337.327
