Difference between revisions of "CPD-19339"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCERATE == * common-name: ** d-glycerate * smiles: ** c(=o)([o-])c(o)co * inchi-key: ** rbnpomfgqqghho-uwtatzphsa-m * molecular-weight:...") |
(Created page with "Category:metabolite == Metabolite CPD-13853 == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) * inch...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13853 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 8-oxo-dgdp |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-])c(o) | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ljmltzsnwocynq-vpeninkcsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 440.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12816]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgdp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ljmltzsnwocynq-vpeninkcsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=440.179}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-13853
- common-name:
- 8-oxo-dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ljmltzsnwocynq-vpeninkcsa-k
- molecular-weight:
- 440.179
