Difference between revisions of "CPD-19339"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Heparan-NAc-Glc-6S == * common-name: ** [heparan sulfate]-α-n-acetyl-d-glucosamine 6-o-sulfate == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-19339 == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-sedoheptulopyranose 7-phosphate |
+ | * smiles: | ||
+ | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) | ||
+ | * inchi-key: | ||
+ | ** cbidvwsruuodhl-ovhbtucosa-l | ||
+ | * molecular-weight: | ||
+ | ** 288.147 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-9140]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-sedoheptulopyranose 7-phosphate}} |
+ | {{#set: inchi-key=inchikey=cbidvwsruuodhl-ovhbtucosa-l}} | ||
+ | {{#set: molecular-weight=288.147}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-19339
- common-name:
- α-d-sedoheptulopyranose 7-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1)
- inchi-key:
- cbidvwsruuodhl-ovhbtucosa-l
- molecular-weight:
- 288.147