Difference between revisions of "CPD-19395"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20176 == * transcription-direction: ** negative * right-end-position: ** 620243 * left-end-position: ** 614939 * centisome-position: ** 98.993546...") |
(Created page with "Category:metabolite == Metabolite CPD-19395 == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o * inchi-key: **...") |
||
| (7 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-19395 == |
| − | * | + | * common-name: |
| − | ** | + | ** γ-l-glutamyl-glycylglycine |
| − | * | + | * smiles: |
| − | ** | + | ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** rwazieyjawtklb-yfkpbyrvsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 260.226 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-18092]] |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=γ-l-glutamyl-glycylglycine}} | |
| − | + | {{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}} | |
| − | + | {{#set: molecular-weight=260.226}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-19395
- common-name:
- γ-l-glutamyl-glycylglycine
- smiles:
- c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
- inchi-key:
- rwazieyjawtklb-yfkpbyrvsa-m
- molecular-weight:
- 260.226
