Difference between revisions of "CPD-19395"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-292 == * common-name: ** (2e)-hexadecenal * smiles: ** cccccccccccccc=c[ch]=o * inchi-key: ** kljfyxovgvxzkt-ccezhusrsa-n * molecular...") |
(Created page with "Category:metabolite == Metabolite CPD-19395 == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o * inchi-key: **...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19395 == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl-glycylglycine |
* smiles: | * smiles: | ||
| − | ** | + | ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rwazieyjawtklb-yfkpbyrvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 260.226 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-18092]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-glycylglycine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=260.226}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-19395
- common-name:
- γ-l-glutamyl-glycylglycine
- smiles:
- c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
- inchi-key:
- rwazieyjawtklb-yfkpbyrvsa-m
- molecular-weight:
- 260.226
