Difference between revisions of "CPD-19395"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Holo-EntF == * common-name: ** a holo-[entf peptidyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(s) know...")
(Created page with "Category:metabolite == Metabolite CPD-19395 == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o * inchi-key: **...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Holo-EntF ==
+
== Metabolite CPD-19395 ==
 
* common-name:
 
* common-name:
** a holo-[entf peptidyl-carrier protein]
+
** γ-l-glutamyl-glycylglycine
 +
* smiles:
 +
** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
 +
* inchi-key:
 +
** rwazieyjawtklb-yfkpbyrvsa-m
 +
* molecular-weight:
 +
** 260.226
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15889]]
+
* [[RXN-18092]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a holo-[entf peptidyl-carrier protein]}}
+
{{#set: common-name=γ-l-glutamyl-glycylglycine}}
 +
{{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}}
 +
{{#set: molecular-weight=260.226}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19395

  • common-name:
    • γ-l-glutamyl-glycylglycine
  • smiles:
    • c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
  • inchi-key:
    • rwazieyjawtklb-yfkpbyrvsa-m
  • molecular-weight:
    • 260.226

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality