Difference between revisions of "CPD-194"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02824 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * MALTODEXGLUCOSID-RXN *...") |
(Created page with "Category:metabolite == Metabolite CPD-194 == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) * inchi-key: ** xzkihkmte...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-194 == |
| − | + | * common-name: | |
| − | * | + | ** 4-nitrophenyl phosphate |
| − | + | * smiles: | |
| − | + | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) | |
| − | + | * inchi-key: | |
| − | ** | + | ** xzkihkmtemtjqx-uhfffaoysa-l |
| − | + | * molecular-weight: | |
| − | * | + | ** 217.074 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | {{#set: common-name=4-nitrophenyl phosphate}} |
| − | + | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} | |
| − | ** | + | {{#set: molecular-weight=217.074}} |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | |||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- molecular-weight:
- 217.074
